Online Database of Chemicals from Around the World
|
CAS#: 7495-97-8 Product: Bis(Diethylphosphinic)Anhydride No suppilers available for the product. |
| Name | Bis(Diethylphosphinic)Anhydride |
|---|---|
| Synonyms | 1-(Diethylphosphoryloxy-Ethyl-Phosphoryl)Ethane; Nsc407797; Phosphinic Acid, Diethyl-, Anhydride |
| Molecular Structure |  |
| Molecular Formula | C8H20O3P2 |
| Molecular Weight | 226.19 |
| CAS Registry Number | 7495-97-8 |
| SMILES | C([P](O[P](=O)(CC)CC)(=O)CC)C |
| InChI | 1S/C8H20O3P2/c1-5-12(9,6-2)11-13(10,7-3)8-4/h5-8H2,1-4H3 |
| InChIKey | YNGGKPSGPCNSAF-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 282.623°C at 760 mmHg (Cal.) |
| Flash point | 138.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(Diethylphosphinic)Anhydride |