|
CAS#: 75686-04-3 Product: (2Z,4E,6E,8E)-N-Ethyl-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide No suppilers available for the product. |
| Name | (2Z,4E,6E,8E)-N-Ethyl-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide |
|---|---|
| Synonyms | 13-Cis-N-(Ethyl)Retinamide; 13-Cis-N-Ethyl-Retinamide; Ccris 4295 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H33NO |
| Molecular Weight | 327.51 |
| CAS Registry Number | 75686-04-3 |
| SMILES | C(NC(=O)\C=C(/C=C/C=C(/C=C/C1=C(CCCC1(C)C)C)C)C)C |
| InChI | 1S/C22H33NO/c1-7-23-21(24)16-18(3)11-8-10-17(2)13-14-20-19(4)12-9-15-22(20,5)6/h8,10-11,13-14,16H,7,9,12,15H2,1-6H3,(H,23,24)/b11-8+,14-13+,17-10+,18-16- |
| InChIKey | WKYDOCGICAMTKE-HAPIZUAHSA-N |
| Density | 0.959g/cm3 (Cal.) |
|---|---|
| Boiling point | 502.987°C at 760 mmHg (Cal.) |
| Flash point | 310.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z,4E,6E,8E)-N-Ethyl-3,7-Dimethyl-9-(2,6,6-Trimethyl-1-Cyclohexenyl)Nona-2,4,6,8-Tetraenamide |