Online Database of Chemicals from Around the World
|
CAS#: 79720-28-8 Product: 1,2,5,6-Tetrahydro-N-(2,2,6,6-tetramethyl-4-piperidyl)phthalimide No suppilers available for the product. |
| Name | 1,2,5,6-Tetrahydro-N-(2,2,6,6-tetramethyl-4-piperidyl)phthalimide |
|---|---|
| Synonyms | 2-(2,2,6,6-Tetramethyl-4-Piperidyl)-3A,4,5,7A-Tetrahydroisoindole-1,3-Dione; 2-(2,2,6,6-Tetramethyl-4-Piperidinyl)-3A,4,5,7A-Tetrahydroisoindole-1,3-Dione; 2-(2,2,6,6-Tetramethyl-4-Piperidyl)-3A,4,5,7A-Tetrahydroisoindole-1,3-Quinone |
| Molecular Structure |  |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.40 |
| CAS Registry Number | 79720-28-8 |
| EINECS | 279-247-3 |
| SMILES | CC3(NC(CC(N1C(=O)C2C(C1=O)CCC=C2)C3)(C)C)C |
| InChI | 1S/C17H26N2O2/c1-16(2)9-11(10-17(3,4)18-16)19-14(20)12-7-5-6-8-13(12)15(19)21/h5,7,11-13,18H,6,8-10H2,1-4H3 |
| InChIKey | VVUWERMQUQLKSQ-UHFFFAOYSA-N |
| Density | 1.072g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.213°C at 760 mmHg (Cal.) |
| Flash point | 204.914°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,5,6-Tetrahydro-N-(2,2,6,6-tetramethyl-4-piperidyl)phthalimide |