|
CAS#: 81250-15-9 Product: 1-Allyl-3-Butylbutylxanthine No suppilers available for the product. |
| Name | 1-Allyl-3-Butylbutylxanthine |
|---|---|
| Synonyms | 1-Allyl-3-Butyl-7H-Purine-2,6-Dione; 1-Allyl-3-Butyl-7H-Purine-2,6-Quinone; 3,7-Dihydro-3-Butyl-1-(2-Propenyl)-1H-Purine-2,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 81250-15-9 |
| SMILES | C1=NC2=C([NH]1)C(N(C(N2CCCC)=O)CC=C)=O |
| InChI | 1S/C12H16N4O2/c1-3-5-7-15-10-9(13-8-14-10)11(17)16(6-4-2)12(15)18/h4,8H,2-3,5-7H2,1H3,(H,13,14) |
| InChIKey | GIUPXMWAXSMOAM-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.684°C at 760 mmHg (Cal.) |
| Flash point | 238.461°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Allyl-3-Butylbutylxanthine |