|
CAS#: 824430-71-9 Product: 8,9-Dichloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine No suppilers available for the product. |
| Name | 8,9-Dichloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| Synonyms | (1R,S)-8, |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.13 |
| CAS Registry Number | 824430-71-9 |
| SMILES | CC1CNCCC2=C1C(=C(C=C2)Cl)Cl |
| InChI | 1S/C11H13Cl2N/c1-7-6-14-5-4-8-2-3-9(12)11(13)10(7)8/h2-3,7,14H,4-6H2,1H3 |
| InChIKey | VUYGFWKOVMRUIC-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 140.1±27.9°C (Cal.) |
| Refractive index | 1.54 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,9-Dichloro-1-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine |