|
CAS#: 84625-53-6 Product: 2,4,4-Trimethylnona-6,8-Dien-3-One Oxime No suppilers available for the product. |
| Name | 2,4,4-Trimethylnona-6,8-Dien-3-One Oxime |
|---|---|
| Synonyms | (6E)-2,4,4-Trimethylnona-6,8-Dien-3-One Oxime; 2,4,4-Trimethylnona-6,8-Dien-3-One Oxime |
| Molecular Structure | ![]() |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.30 |
| CAS Registry Number | 84625-53-6 |
| EINECS | 283-424-0 |
| SMILES | C(C(C(=N/O)/C(C)C)(C)C)\C=C\C=C |
| InChI | 1S/C12H21NO/c1-6-7-8-9-12(4,5)11(13-14)10(2)3/h6-8,10,14H,1,9H2,2-5H3/b8-7+,13-11+ |
| InChIKey | JZVFMABEZCKLSU-IGOCJVNJSA-N |
| Density | 0.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 291.626°C at 760 mmHg (Cal.) |
| Flash point | 173.767°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,4-Trimethylnona-6,8-Dien-3-One Oxime |