|
CAS#: 85851-59-8 Product: 2-[(4-Amino-2,5-dimethoxyphenyl)diazenyl]-3-oxo-N-phenylbutanamide No suppilers available for the product. |
| Name | 2-[(4-Amino-2,5-dimethoxyphenyl)diazenyl]-3-oxo-N-phenylbutanamide |
|---|---|
| Synonyms | 2-[(4-ami |
| Molecular Structure | ![]() |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 |
| CAS Registry Number | 85851-59-8 |
| EINECS | 288-619-4 |
| SMILES | COc2cc(N)c(cc2N=NC(C(C)=O)C(=O)Nc1ccccc1)OC |
| InChI | 1S/C18H20N4O4/c1-11(23)17(18(24)20-12-7-5-4-6-8-12)22-21-14-10-15(25-2)13(19)9-16(14)26-3/h4-10,17H,19H2,1-3H3,(H,20,24) |
| InChIKey | VXBVFMRXFGMBHL-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 594.383°C at 760 mmHg (Cal.) |
| Flash point | 313.272°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Amino-2,5-dimethoxyphenyl)diazenyl]-3-oxo-N-phenylbutanamide |