|
CAS#: 91333-63-0 Product: 5,6-Dihydro-3-Methyl-5,5-Dipropyl-2H-1,3-Oxazine-2,4(3H)-Dione No suppilers available for the product. |
| Name | 5,6-Dihydro-3-Methyl-5,5-Dipropyl-2H-1,3-Oxazine-2,4(3H)-Dione |
|---|---|
| Synonyms | 3-Methyl-5,5-Dipropyl-1,3-Oxazinane-2,4-Quinone; 2H-1,3-Oxazine-2,4(3H)-Dione, Dihydro-3-Methyl-5,5-Dipropyl-; Brn 0169853 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 |
| CAS Registry Number | 91333-63-0 |
| SMILES | C(C1(C(=O)N(C(OC1)=O)C)CCC)CC |
| InChI | 1S/C11H19NO3/c1-4-6-11(7-5-2)8-15-10(14)12(3)9(11)13/h4-8H2,1-3H3 |
| InChIKey | XPJPWKBTMHAHAN-UHFFFAOYSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.435°C at 760 mmHg (Cal.) |
| Flash point | 149.408°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6-Dihydro-3-Methyl-5,5-Dipropyl-2H-1,3-Oxazine-2,4(3H)-Dione |