|
CAS#: 919119-66-7 Product: Ethyl 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carboxylate No suppilers available for the product. |
| Name | Ethyl 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carboxylate |
|---|---|
| Synonyms | 1H-Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24BNO4 |
| Molecular Weight | 329.20 |
| CAS Registry Number | 919119-66-7 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)c2cccc3c2[nH]c(c3C(=O)OCC)C |
| InChI | 1S/C18H24BNO4/c1-7-22-16(21)14-11(2)20-15-12(14)9-8-10-13(15)19-23-17(3,4)18(5,6)24-19/h8-10,20H,7H2,1-6H3 |
| InChIKey | KRSFWFJCVUCAQS-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 472.6±40.0°C at 760 mmHg (Cal.) |
| Flash point | 239.6±27.3°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-3-carboxylate |