|
CAS#: 919788-60-6 Product: 8-chloro-7-fluoro-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one No suppilers available for the product. |
| Name | 8-chloro-7-fluoro-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one |
|---|---|
| Synonyms | Pyrido[3, |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClFN2O2 |
| Molecular Weight | 230.62 |
| CAS Registry Number | 919788-60-6 |
| SMILES | CN1CCOc2c(cc(c(n2)Cl)F)C1=O |
| InChI | 1S/C9H8ClFN2O2/c1-13-2-3-15-8-5(9(13)14)4-6(11)7(10)12-8/h4H,2-3H2,1H3 |
| InChIKey | QMMZYKPTRCBUJV-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.333°C at 760 mmHg (Cal.) |
| Flash point | 197.729°C (Cal.) |
| Refractive index | 1.548 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-chloro-7-fluoro-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one |