|
CAS#: 93778-58-6 Product: 3'-O-Benzoyl-2'-deoxyinosine No suppilers available for the product. |
| Name | 3'-O-Benzoyl-2'-deoxyinosine |
|---|---|
| Synonyms | 2'-deoxyinosine 3'-benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16N4O5 |
| Molecular Weight | 356.33 |
| CAS Registry Number | 93778-58-6 |
| EINECS | 298-196-8 |
| SMILES | Oc4ncnc3c4ncn3[C@H]2C[C@H](OC(=O)c1ccccc1)[C@@H](CO)O2 |
| InChI | 1S/C17H16N4O5/c22-7-12-11(26-17(24)10-4-2-1-3-5-10)6-13(25-12)21-9-20-14-15(21)18-8-19-16(14)23/h1-5,8-9,11-13,22H,6-7H2,(H,18,19,23)/t11-,12+,13+/m0/s1 |
| InChIKey | RZQPZGXOKJLURQ-YNEHKIRRSA-N |
| Density | 1.606g/cm3 (Cal.) |
|---|---|
| Boiling point | 631.827°C at 760 mmHg (Cal.) |
| Flash point | 335.917°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3'-O-Benzoyl-2'-deoxyinosine |