|
CAS#: 93857-44-4 Product: Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl phosphate No suppilers available for the product. |
| Name | Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl phosphate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H12F17N2O4P |
| Molecular Weight | 578.16 |
| CAS Registry Number | 93857-44-4 |
| EINECS | 299-178-2 |
| SMILES | [NH4+].[NH4+].[O-]P([O-])(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | 1S/C10H6F17O4P.2H3N/c11-3(12,1-2-31-32(28,29)30)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27;;/h1-2H2,(H2,28,29,30);2*1H3 |
| InChIKey | JORZSJZWIWDUEC-UHFFFAOYSA-N |
| Boiling point | 392.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 191.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diammonium 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl phosphate |