|
CAS#: 93963-67-8 Product: 1-O-(3-Amino-2-hydroxypropyl)-D-glucitol hydrochloride (1:1) No suppilers available for the product. |
| Name | 1-O-(3-Amino-2-hydroxypropyl)-D-glucitol hydrochloride (1:1) |
|---|---|
| Synonyms | 1-O-(3-amino-2-hydroxypropyl)-D-glucitol hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H22ClNO7 |
| Molecular Weight | 291.73 |
| CAS Registry Number | 93963-67-8 |
| EINECS | 300-811-2 |
| SMILES | Cl.NCC(O)COC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | 1S/C9H21NO7.ClH/c10-1-5(12)3-17-4-7(14)9(16)8(15)6(13)2-11;/h5-9,11-16H,1-4,10H2;1H/t5?,6-,7+,8-,9-;/m1./s1 |
| InChIKey | NRSCURTUGURNPH-RXFLVXJHSA-N |
| Boiling point | 598.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 315.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-O-(3-Amino-2-hydroxypropyl)-D-glucitol hydrochloride (1:1) |