|
CAS#: 94159-41-8 Product: Bis(3,5-Dibromo-4-Hydroxyphenyl)Acetic Acid No suppilers available for the product. |
| Name | Bis(3,5-Dibromo-4-Hydroxyphenyl)Acetic Acid |
|---|---|
| Synonyms | 2,2-Bis(3,5-Dibromo-4-Hydroxy-Phenyl)Acetic Acid; 2,2-Bis(3,5-Dibromo-4-Hydroxy-Phenyl)Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8Br4O4 |
| Molecular Weight | 559.83 |
| CAS Registry Number | 94159-41-8 |
| EINECS | 303-220-8 |
| SMILES | C1=C(C(=C(C=C1C(C2=CC(=C(C(=C2)Br)O)Br)C(O)=O)Br)O)Br |
| InChI | 1S/C14H8Br4O4/c15-7-1-5(2-8(16)12(7)19)11(14(21)22)6-3-9(17)13(20)10(18)4-6/h1-4,11,19-20H,(H,21,22) |
| InChIKey | FVYXZKBOFHWUDL-UHFFFAOYSA-N |
| Density | 2.31g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.873°C at 760 mmHg (Cal.) |
| Flash point | 268.815°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(3,5-Dibromo-4-Hydroxyphenyl)Acetic Acid |