|
CAS#: 94442-14-5 Product: methyl 2-ethoxy-8-ethyl-5-oxo-pyrido[6,5-d]pyrimidine-6-carboxylate No suppilers available for the product. |
| Name | methyl 2-ethoxy-8-ethyl-5-oxo-pyrido[6,5-d]pyrimidine-6-carboxylate |
|---|---|
| Synonyms | methyl 2- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 |
| CAS Registry Number | 94442-14-5 |
| EINECS | 305-340-6 |
| SMILES | COC(=O)C2=CN(CC)c1nc(ncc1C2=O)OCC |
| InChI | 1S/C13H15N3O4/c1-4-16-7-9(12(18)19-3)10(17)8-6-14-13(20-5-2)15-11(8)16/h6-7H,4-5H2,1-3H3 |
| InChIKey | VHRBIIJTOIRWRO-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 424.261°C at 760 mmHg (Cal.) |
| Flash point | 210.386°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for methyl 2-ethoxy-8-ethyl-5-oxo-pyrido[6,5-d]pyrimidine-6-carboxylate |