|
CAS#: 97389-71-4 Product: 1-{5-Methoxy-2-[(trimethylsilyl)oxy]phenyl}ethanone No suppilers available for the product. |
| Name | 1-{5-Methoxy-2-[(trimethylsilyl)oxy]phenyl}ethanone |
|---|---|
| Synonyms | 1-(5-Methoxy-2-[(trimethylsilyl)oxy]phenyl)ethanone #; 2'-Hydroxy-5'-methoxyacetophenone, trimethylsilyl ether |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O3Si |
| Molecular Weight | 238.35 |
| CAS Registry Number | 97389-71-4 |
| SMILES | O=C(c1cc(OC)ccc1O[Si](C)(C)C)C |
| InChI | 1S/C12H18O3Si/c1-9(13)11-8-10(14-2)6-7-12(11)15-16(3,4)5/h6-8H,1-5H3 |
| InChIKey | RRJSUXCETPFDSN-UHFFFAOYSA-N |
| Density | 1.003g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.05°C at 760 mmHg (Cal.) |
| Flash point | 117.474°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{5-Methoxy-2-[(trimethylsilyl)oxy]phenyl}ethanone |