| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Nicergoline EP Impurity B |
|---|---|
| Synonyms | [(6aR,9R,10aS)-10a-methoxy-7-methyl-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinolin-9-yl]methyl 5-bromopyridine-3-carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H24BrN3O3 |
| Molecular Weight | 470.36 |
| CAS Registry Number | 35264-46-1 |
| SMILES | CN1C[C@@H](C[C@]2([C@H]1CC3=CNC4=CC=CC2=C34)OC)COC(=O)C5=CC(=CN=C5)Br |
| Solubility | 2.089 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.684, Calc.* |
| Melting point | 237.32 ºC |
| Boiling Point | 552.93 ºC, 592.2±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 312.0±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302 Details |
| Precautionary Statements | P264-P301+P312 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Nicergoline EP Impurity B |