|
CAS#: 91296-12-7 Product: 2-Amino-1,9-Dihydro-9-(3-Hydroxy-4-(Hydroxymethyl)Cyclopentyl)-6H-Purine-6-One No suppilers available for the product. |
| Name | 2-Amino-1,9-Dihydro-9-(3-Hydroxy-4-(Hydroxymethyl)Cyclopentyl)-6H-Purine-6-One |
|---|---|
| Synonyms | 2-Amino-9-(3-Hydroxy-4-Methylol-Cyclopentyl)-3H-Purin-6-One; Nsc260601 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 |
| CAS Registry Number | 91296-12-7 |
| SMILES | C1=NC3=C([N]1C2CC(O)C(C2)CO)NC(=NC3=O)N |
| InChI | 1S/C11H15N5O3/c12-11-14-9-8(10(19)15-11)13-4-16(9)6-1-5(3-17)7(18)2-6/h4-7,17-18H,1-3H2,(H3,12,14,15,19) |
| InChIKey | ZEKJSNVOQKQOFO-UHFFFAOYSA-N |
| Density | 1.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 656.318°C at 760 mmHg (Cal.) |
| Flash point | 350.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1,9-Dihydro-9-(3-Hydroxy-4-(Hydroxymethyl)Cyclopentyl)-6H-Purine-6-One |